C24H17N5O — CID 91131279
2-(4-methyl-2-pyridinyl)-N-(1,10-phenanthrolin-5-yl)pyridine-4-carboxamide (PubChem CID 91131279) has the molecular formula C24H17N5O and a molecular weight of 391.43 g/mol. Its IUPAC name is 2-(4-methyl-2-pyridinyl)-N-(1,10-phenanthrolin-5-yl)pyridine-4-carboxamide.
| Compound Name | 2-(4-methyl-2-pyridinyl)-N-(1,10-phenanthrolin-5-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 91131279 |
| Molecular Formula | C24H17N5O |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 2-(4-methyl-2-pyridinyl)-N-(1,10-phenanthrolin-5-yl)pyridine-4-carboxamide |
| SMILES | Cc1ccnc(-c2cc(C(=O)Nc3cc4cccnc4c4ncccc34)ccn2)c1 |
| InChI | InChI=1S/C24H17N5O/c1-15-6-10-25-20(12-15)21-14-17(7-11-26-21)24(30)29-19-13-16-4-2-8-27-22(16)23-18(19)5-3-9-28-23/h2-14H,1H3,(H,29,30) |
| InChIKey | JMRWWQYZEWLMCT-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|