C31H22ClN6O4PS — CID 91131292
[3-[6-[2-(azidomethyl)phenyl]sulfanyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-4-chlorophenyl] diphenyl phosphate (PubChem CID 91131292) has the molecular formula C31H22ClN6O4PS and a molecular weight of 641.05 g/mol. Its IUPAC name is [3-[6-[2-(azidomethyl)phenyl]sulfanyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-4-chlorophenyl] diphenyl phosphate.
| Compound Name | [3-[6-[2-(azidomethyl)phenyl]sulfanyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-4-chlorophenyl] diphenyl phosphate |
|---|---|
| PubChem CID | 91131292 |
| Molecular Formula | C31H22ClN6O4PS |
| Molecular Weight | 641.05 g/mol |
| Exact Mass | 640.08 |
| IUPAC Name | [3-[6-[2-(azidomethyl)phenyl]sulfanyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-4-chlorophenyl] diphenyl phosphate |
| SMILES | [N-]=[N+]=NCc1ccccc1Sc1ccc2nnc(-c3cc(OP(=O)(Oc4ccccc4)Oc4ccccc4)ccc3Cl)n2c1 |
| InChI | InChI=1S/C31H22ClN6O4PS/c32-28-17-15-25(42-43(39,40-23-10-3-1-4-11-23)41-24-12-5-2-6-13-24)19-27(28)31-36-35-30-18-16-26(21-38(30)31)44-29-14-8-7-9-22(29)20-34-37-33/h1-19,21H,20H2 |
| InChIKey | LBKYVKFQYOBRLR-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 123.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.05 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|