About [3-oxo-6-(trifluoromethoxy)-1,4-benzoxazin-4-yl] butanoate
[3-oxo-6-(trifluoromethoxy)-1,4-benzoxazin-4-yl] butanoate (PubChem CID 91131503) has the molecular formula C13H12F3NO5
and a molecular weight of 319.24 g/mol. Its IUPAC name is [3-oxo-6-(trifluoromethoxy)-1,4-benzoxazin-4-yl] butanoate.
Molecular Properties
| Compound Name | [3-oxo-6-(trifluoromethoxy)-1,4-benzoxazin-4-yl] butanoate |
| PubChem CID | 91131503 |
| Molecular Formula | C13H12F3NO5 |
| Molecular Weight | 319.24 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | [3-oxo-6-(trifluoromethoxy)-1,4-benzoxazin-4-yl] butanoate |
| SMILES | CCCC(=O)ON1C(=O)COc2ccc(OC(F)(F)F)cc21 |
| InChI | InChI=1S/C13H12F3NO5/c1-2-3-12(19)22-17-9-6-8(21-13(14,15)16)4-5-10(9)20-7-11(17)18/h4-6H,2-3,7H2,1H3 |
| InChIKey | ZASXCJKECBTFHD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.24 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-oxo-6-(trifluoromethoxy)-1,4-benzoxazin-4-yl] butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-oxo-6-(trifluoromethoxy)-1,4-benzoxazin-4-yl] butanoate?
The IUPAC name of [3-oxo-6-(trifluoromethoxy)-1,4-benzoxazin-4-yl] butanoate (CID 91131503) is [3-oxo-6-(trifluoromethoxy)-1,4-benzoxazin-4-yl] butanoate.
What is the SMILES notation for [3-oxo-6-(trifluoromethoxy)-1,4-benzoxazin-4-yl] butanoate?
The canonical SMILES for [3-oxo-6-(trifluoromethoxy)-1,4-benzoxazin-4-yl] butanoate is CCCC(=O)ON1C(=O)COc2ccc(OC(F)(F)F)cc21.
What is the InChIKey of [3-oxo-6-(trifluoromethoxy)-1,4-benzoxazin-4-yl] butanoate?
The InChIKey is ZASXCJKECBTFHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F3NO5/c1-2-3-12(19)22-17-9-6-8(21-13(14,15)16)4-5-10(9)20-7-11(17)18/h4-6H,2-3,7H2,1H3.
What are the key properties of [3-oxo-6-(trifluoromethoxy)-1,4-benzoxazin-4-yl] butanoate?
[3-oxo-6-(trifluoromethoxy)-1,4-benzoxazin-4-yl] butanoate has a molecular weight of 319.24 g/mol, XLogP of 2.57, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-oxo-6-(trifluoromethoxy)-1,4-benzoxazin-4-yl] butanoate is sourced from PubChem (CID 91131503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).