C19H25N3O5S — CID 9113172
N-tert-butyl-4-[methyl(2-phenoxyethyl)amino]-3-nitrobenzenesulfonamide (PubChem CID 9113172) has the molecular formula C19H25N3O5S and a molecular weight of 407.49 g/mol. Its IUPAC name is N-tert-butyl-4-[methyl(2-phenoxyethyl)amino]-3-nitrobenzenesulfonamide.
| Compound Name | N-tert-butyl-4-[methyl(2-phenoxyethyl)amino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 9113172 |
| Molecular Formula | C19H25N3O5S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | N-tert-butyl-4-[methyl(2-phenoxyethyl)amino]-3-nitrobenzenesulfonamide |
| SMILES | CN(CCOc1ccccc1)c1ccc(S(=O)(=O)NC(C)(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H25N3O5S/c1-19(2,3)20-28(25,26)16-10-11-17(18(14-16)22(23)24)21(4)12-13-27-15-8-6-5-7-9-15/h5-11,14,20H,12-13H2,1-4H3 |
| InChIKey | WUMWFNOMBREHPU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|