C16H29N3 — CID 91132155
1-(3,7-dimethylnona-3,5,7-trien-4-yl)-2,2-dimethylimidazolidin-4-amine (PubChem CID 91132155) has the molecular formula C16H29N3 and a molecular weight of 263.43 g/mol. Its IUPAC name is 1-(3,7-dimethylnona-3,5,7-trien-4-yl)-2,2-dimethylimidazolidin-4-amine.
| Compound Name | 1-(3,7-dimethylnona-3,5,7-trien-4-yl)-2,2-dimethylimidazolidin-4-amine |
|---|---|
| PubChem CID | 91132155 |
| Molecular Formula | C16H29N3 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.24 |
| IUPAC Name | 1-(3,7-dimethylnona-3,5,7-trien-4-yl)-2,2-dimethylimidazolidin-4-amine |
| SMILES | CC=C(C)C=CC(=C(C)CC)N1CC(N)NC1(C)C |
| InChI | InChI=1S/C16H29N3/c1-7-12(3)9-10-14(13(4)8-2)19-11-15(17)18-16(19,5)6/h7,9-10,15,18H,8,11,17H2,1-6H3 |
| InChIKey | JGFPDCAFTAEPNU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|