About quinoxalin-2-yl N-[2-(2,7-dimethyl-1H-indol-3-yl)ethyl]carbamate
quinoxalin-2-yl N-[2-(2,7-dimethyl-1H-indol-3-yl)ethyl]carbamate (PubChem CID 91132976) has the molecular formula C21H20N4O2
and a molecular weight of 360.42 g/mol. Its IUPAC name is quinoxalin-2-yl N-[2-(2,7-dimethyl-1H-indol-3-yl)ethyl]carbamate.
Molecular Properties
| Compound Name | quinoxalin-2-yl N-[2-(2,7-dimethyl-1H-indol-3-yl)ethyl]carbamate |
| PubChem CID | 91132976 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | quinoxalin-2-yl N-[2-(2,7-dimethyl-1H-indol-3-yl)ethyl]carbamate |
| SMILES | Cc1[nH]c2c(C)cccc2c1CCNC(=O)Oc1cnc2ccccc2n1 |
| InChI | InChI=1S/C21H20N4O2/c1-13-6-5-7-16-15(14(2)24-20(13)16)10-11-22-21(26)27-19-12-23-17-8-3-4-9-18(17)25-19/h3-9,12,24H,10-11H2,1-2H3,(H,22,26) |
| InChIKey | BNCMQEIQPGASRT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze quinoxalin-2-yl N-[2-(2,7-dimethyl-1H-indol-3-yl)ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinoxalin-2-yl N-[2-(2,7-dimethyl-1H-indol-3-yl)ethyl]carbamate?
The IUPAC name of quinoxalin-2-yl N-[2-(2,7-dimethyl-1H-indol-3-yl)ethyl]carbamate (CID 91132976) is quinoxalin-2-yl N-[2-(2,7-dimethyl-1H-indol-3-yl)ethyl]carbamate.
What is the SMILES notation for quinoxalin-2-yl N-[2-(2,7-dimethyl-1H-indol-3-yl)ethyl]carbamate?
The canonical SMILES for quinoxalin-2-yl N-[2-(2,7-dimethyl-1H-indol-3-yl)ethyl]carbamate is Cc1[nH]c2c(C)cccc2c1CCNC(=O)Oc1cnc2ccccc2n1.
What is the InChIKey of quinoxalin-2-yl N-[2-(2,7-dimethyl-1H-indol-3-yl)ethyl]carbamate?
The InChIKey is BNCMQEIQPGASRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N4O2/c1-13-6-5-7-16-15(14(2)24-20(13)16)10-11-22-21(26)27-19-12-23-17-8-3-4-9-18(17)25-19/h3-9,12,24H,10-11H2,1-2H3,(H,22,26).
What are the key properties of quinoxalin-2-yl N-[2-(2,7-dimethyl-1H-indol-3-yl)ethyl]carbamate?
quinoxalin-2-yl N-[2-(2,7-dimethyl-1H-indol-3-yl)ethyl]carbamate has a molecular weight of 360.42 g/mol, XLogP of 4.06, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for quinoxalin-2-yl N-[2-(2,7-dimethyl-1H-indol-3-yl)ethyl]carbamate is sourced from PubChem (CID 91132976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).