C19H19N — CID 91133251
8-(2,4-dimethylphenyl)-1,2,3,4-tetrahydrocyclopenta[b]indole (PubChem CID 91133251) has the molecular formula C19H19N and a molecular weight of 261.37 g/mol. Its IUPAC name is 8-(2,4-dimethylphenyl)-1,2,3,4-tetrahydrocyclopenta[b]indole.
| Compound Name | 8-(2,4-dimethylphenyl)-1,2,3,4-tetrahydrocyclopenta[b]indole |
|---|---|
| PubChem CID | 91133251 |
| Molecular Formula | C19H19N |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 8-(2,4-dimethylphenyl)-1,2,3,4-tetrahydrocyclopenta[b]indole |
| SMILES | Cc1ccc(-c2cccc3[nH]c4c(c23)CCC4)c(C)c1 |
| InChI | InChI=1S/C19H19N/c1-12-9-10-14(13(2)11-12)15-5-3-8-18-19(15)16-6-4-7-17(16)20-18/h3,5,8-11,20H,4,6-7H2,1-2H3 |
| InChIKey | HMMISIKJOBAIGQ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |