About 4-(2,3-dimethylbutyl)-1,3-dihydroimidazole-2-thione
4-(2,3-dimethylbutyl)-1,3-dihydroimidazole-2-thione (PubChem CID 91133437) has the molecular formula C9H15N2S+
and a molecular weight of 183.30 g/mol. Its IUPAC name is 4-(2,3-dimethylbutyl)-1,3-dihydroimidazole-2-thione.
Molecular Properties
| Compound Name | 4-(2,3-dimethylbutyl)-1,3-dihydroimidazole-2-thione |
| PubChem CID | 91133437 |
| Molecular Formula | C9H15N2S+ |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 4-(2,3-dimethylbutyl)-1,3-dihydroimidazole-2-thione |
| SMILES | C[C+](C)C(C)Cc1c[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C9H14N2S/c1-6(2)7(3)4-8-5-10-9(12)11-8/h5,7H,4H2,1-3H3,(H-,10,11,12)/p+1 |
| InChIKey | QYHVRBNLVUIJEL-UHFFFAOYSA-O |
| XLogP | 2.87 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,3-dimethylbutyl)-1,3-dihydroimidazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,3-dimethylbutyl)-1,3-dihydroimidazole-2-thione?
The IUPAC name of 4-(2,3-dimethylbutyl)-1,3-dihydroimidazole-2-thione (CID 91133437) is 4-(2,3-dimethylbutyl)-1,3-dihydroimidazole-2-thione.
What is the SMILES notation for 4-(2,3-dimethylbutyl)-1,3-dihydroimidazole-2-thione?
The canonical SMILES for 4-(2,3-dimethylbutyl)-1,3-dihydroimidazole-2-thione is C[C+](C)C(C)Cc1c[nH]c(=S)[nH]1.
What is the InChIKey of 4-(2,3-dimethylbutyl)-1,3-dihydroimidazole-2-thione?
The InChIKey is QYHVRBNLVUIJEL-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H14N2S/c1-6(2)7(3)4-8-5-10-9(12)11-8/h5,7H,4H2,1-3H3,(H-,10,11,12)/p+1.
What are the key properties of 4-(2,3-dimethylbutyl)-1,3-dihydroimidazole-2-thione?
4-(2,3-dimethylbutyl)-1,3-dihydroimidazole-2-thione has a molecular weight of 183.30 g/mol, XLogP of 2.87, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dimethylbutyl)-1,3-dihydroimidazole-2-thione is sourced from PubChem (CID 91133437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).