About ethane;5-ethyl-2,3-dimethylcyclohexane-1,4-diol
ethane;5-ethyl-2,3-dimethylcyclohexane-1,4-diol (PubChem CID 91133722) has the molecular formula C12H25O2-
and a molecular weight of 201.33 g/mol. Its IUPAC name is ethane;5-ethyl-2,3-dimethylcyclohexane-1,4-diol.
Molecular Properties
| Compound Name | ethane;5-ethyl-2,3-dimethylcyclohexane-1,4-diol |
| PubChem CID | 91133722 |
| Molecular Formula | C12H25O2- |
| Molecular Weight | 201.33 g/mol |
| Exact Mass | 201.19 |
| IUPAC Name | ethane;5-ethyl-2,3-dimethylcyclohexane-1,4-diol |
| SMILES | CC.[CH2-]CC1CC(O)C(C)C(C)C1O |
| InChI | InChI=1S/C10H19O2.C2H6/c1-4-8-5-9(11)6(2)7(3)10(8)12;1-2/h6-12H,1,4-5H2,2-3H3;1-2H3/q-1; |
| InChIKey | UZQAMRDRGAMJLQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethane;5-ethyl-2,3-dimethylcyclohexane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-ethyl-2,3-dimethylcyclohexane-1,4-diol?
The IUPAC name of ethane;5-ethyl-2,3-dimethylcyclohexane-1,4-diol (CID 91133722) is ethane;5-ethyl-2,3-dimethylcyclohexane-1,4-diol.
What is the SMILES notation for ethane;5-ethyl-2,3-dimethylcyclohexane-1,4-diol?
The canonical SMILES for ethane;5-ethyl-2,3-dimethylcyclohexane-1,4-diol is CC.[CH2-]CC1CC(O)C(C)C(C)C1O.
What is the InChIKey of ethane;5-ethyl-2,3-dimethylcyclohexane-1,4-diol?
The InChIKey is UZQAMRDRGAMJLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19O2.C2H6/c1-4-8-5-9(11)6(2)7(3)10(8)12;1-2/h6-12H,1,4-5H2,2-3H3;1-2H3/q-1;.
What are the key properties of ethane;5-ethyl-2,3-dimethylcyclohexane-1,4-diol?
ethane;5-ethyl-2,3-dimethylcyclohexane-1,4-diol has a molecular weight of 201.33 g/mol, XLogP of 2.25, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-ethyl-2,3-dimethylcyclohexane-1,4-diol is sourced from PubChem (CID 91133722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).