About 4-(4-fluorophenyl)-1,4-azaphosphinane
4-(4-fluorophenyl)-1,4-azaphosphinane (PubChem CID 91133742) has the molecular formula C10H13FNP
and a molecular weight of 197.19 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-1,4-azaphosphinane.
Molecular Properties
| Compound Name | 4-(4-fluorophenyl)-1,4-azaphosphinane |
| PubChem CID | 91133742 |
| Molecular Formula | C10H13FNP |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 4-(4-fluorophenyl)-1,4-azaphosphinane |
| SMILES | Fc1ccc(P2CCNCC2)cc1 |
| InChI | InChI=1S/C10H13FNP/c11-9-1-3-10(4-2-9)13-7-5-12-6-8-13/h1-4,12H,5-8H2 |
| InChIKey | BVVGFUHVKKCYLD-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-fluorophenyl)-1,4-azaphosphinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-fluorophenyl)-1,4-azaphosphinane?
The IUPAC name of 4-(4-fluorophenyl)-1,4-azaphosphinane (CID 91133742) is 4-(4-fluorophenyl)-1,4-azaphosphinane.
What is the SMILES notation for 4-(4-fluorophenyl)-1,4-azaphosphinane?
The canonical SMILES for 4-(4-fluorophenyl)-1,4-azaphosphinane is Fc1ccc(P2CCNCC2)cc1.
What is the InChIKey of 4-(4-fluorophenyl)-1,4-azaphosphinane?
The InChIKey is BVVGFUHVKKCYLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13FNP/c11-9-1-3-10(4-2-9)13-7-5-12-6-8-13/h1-4,12H,5-8H2.
What are the key properties of 4-(4-fluorophenyl)-1,4-azaphosphinane?
4-(4-fluorophenyl)-1,4-azaphosphinane has a molecular weight of 197.19 g/mol, XLogP of 1.54, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-fluorophenyl)-1,4-azaphosphinane is sourced from PubChem (CID 91133742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).