About (2R)-2-(oxan-4-yl)-1,3-thiazolidine-3,4-dicarboxylic acid
(2R)-2-(oxan-4-yl)-1,3-thiazolidine-3,4-dicarboxylic acid (PubChem CID 91134555) has the molecular formula C10H15NO5S
and a molecular weight of 261.30 g/mol. Its IUPAC name is (2R)-2-(oxan-4-yl)-1,3-thiazolidine-3,4-dicarboxylic acid.
Molecular Properties
| Compound Name | (2R)-2-(oxan-4-yl)-1,3-thiazolidine-3,4-dicarboxylic acid |
| PubChem CID | 91134555 |
| Molecular Formula | C10H15NO5S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | (2R)-2-(oxan-4-yl)-1,3-thiazolidine-3,4-dicarboxylic acid |
| SMILES | O=C(O)C1CS[C@H](C2CCOCC2)N1C(=O)O |
| InChI | InChI=1S/C10H15NO5S/c12-9(13)7-5-17-8(11(7)10(14)15)6-1-3-16-4-2-6/h6-8H,1-5H2,(H,12,13)(H,14,15)/t7?,8-/m1/s1 |
| InChIKey | VKCLZWFZTLGRLO-BRFYHDHCSA-N |
| XLogP | 0.92 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-2-(oxan-4-yl)-1,3-thiazolidine-3,4-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(oxan-4-yl)-1,3-thiazolidine-3,4-dicarboxylic acid?
The IUPAC name of (2R)-2-(oxan-4-yl)-1,3-thiazolidine-3,4-dicarboxylic acid (CID 91134555) is (2R)-2-(oxan-4-yl)-1,3-thiazolidine-3,4-dicarboxylic acid.
What is the SMILES notation for (2R)-2-(oxan-4-yl)-1,3-thiazolidine-3,4-dicarboxylic acid?
The canonical SMILES for (2R)-2-(oxan-4-yl)-1,3-thiazolidine-3,4-dicarboxylic acid is O=C(O)C1CS[C@H](C2CCOCC2)N1C(=O)O.
What is the InChIKey of (2R)-2-(oxan-4-yl)-1,3-thiazolidine-3,4-dicarboxylic acid?
The InChIKey is VKCLZWFZTLGRLO-BRFYHDHCSA-N. The full InChI is InChI=1S/C10H15NO5S/c12-9(13)7-5-17-8(11(7)10(14)15)6-1-3-16-4-2-6/h6-8H,1-5H2,(H,12,13)(H,14,15)/t7?,8-/m1/s1.
What are the key properties of (2R)-2-(oxan-4-yl)-1,3-thiazolidine-3,4-dicarboxylic acid?
(2R)-2-(oxan-4-yl)-1,3-thiazolidine-3,4-dicarboxylic acid has a molecular weight of 261.30 g/mol, XLogP of 0.92, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(oxan-4-yl)-1,3-thiazolidine-3,4-dicarboxylic acid is sourced from PubChem (CID 91134555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).