C60H44F20N4 — CID 91135125
2,3,7,8,17,18,22,24-octaethyl-5,10,15,20-tetrakis(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin (PubChem CID 91135125) has the molecular formula C60H44F20N4 and a molecular weight of 1201.00 g/mol. Its IUPAC name is 2,3,7,8,17,18,22,24-octaethyl-5,10,15,20-tetrakis(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin.
| Compound Name | 2,3,7,8,17,18,22,24-octaethyl-5,10,15,20-tetrakis(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 91135125 |
| Molecular Formula | C60H44F20N4 |
| Molecular Weight | 1201.00 g/mol |
| Exact Mass | 1200.32 |
| IUPAC Name | 2,3,7,8,17,18,22,24-octaethyl-5,10,15,20-tetrakis(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin |
| SMILES | CCc1c2[nH]c(c1CC)C(c1c(F)c(F)c(F)c(F)c1F)=c1c(CC)c(CC)c(n1CC)=C(c1c(F)c(F)c(F)c(F)c1F)c1ccc([nH]1)C(c1c(F)c(F)c(F)c(F)c1F)=c1c(CC)c(CC)c(n1CC)=C2c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C60H44F20N4/c1-9-19-20(10-2)56-34(32-41(67)49(75)54(80)50(76)42(32)68)60-24(14-6)22(12-4)58(84(60)16-8)28(30-37(63)45(71)52(78)46(72)38(30)64)26-18-17-25(81-26)27(29-35(61)43(69)51(77)44(70)36(29)62)57-21(11-3)23(13-5)59(83(57)15-7)33(55(19)82-56)31-39(65)47(73)53(79)48(74)40(31)66/h17-18,81-82H,9-16H2,1-8H3 |
| InChIKey | STOHHPYCLPPDQQ-UHFFFAOYSA-N |
| XLogP | 13.44 |
| TPSA | 41.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1201.00 |
| LogP ≤ 5 | 13.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|