About N-dimethyl-N-(3,5,5-trimethyl-2-oxopyrrolidin-3-yl)boronamidic acid;ethane
N-dimethyl-N-(3,5,5-trimethyl-2-oxopyrrolidin-3-yl)boronamidic acid;ethane (PubChem CID 91135814) has the molecular formula C11H25BN2O2
and a molecular weight of 228.14 g/mol. Its IUPAC name is N-dimethyl-N-(3,5,5-trimethyl-2-oxopyrrolidin-3-yl)boronamidic acid;ethane.
Molecular Properties
| Compound Name | N-dimethyl-N-(3,5,5-trimethyl-2-oxopyrrolidin-3-yl)boronamidic acid;ethane |
| PubChem CID | 91135814 |
| Molecular Formula | C11H25BN2O2 |
| Molecular Weight | 228.14 g/mol |
| Exact Mass | 228.20 |
| IUPAC Name | N-dimethyl-N-(3,5,5-trimethyl-2-oxopyrrolidin-3-yl)boronamidic acid;ethane |
| SMILES | CB(O)N(C)C1(C)CC(C)(C)NC1=O.CC |
| InChI | InChI=1S/C9H19BN2O2.C2H6/c1-8(2)6-9(3,7(13)11-8)12(5)10(4)14;1-2/h14H,6H2,1-5H3,(H,11,13);1-2H3 |
| InChIKey | SMNLMNDNVYCZLS-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.14 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-dimethyl-N-(3,5,5-trimethyl-2-oxopyrrolidin-3-yl)boronamidic acid;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-dimethyl-N-(3,5,5-trimethyl-2-oxopyrrolidin-3-yl)boronamidic acid;ethane?
The IUPAC name of N-dimethyl-N-(3,5,5-trimethyl-2-oxopyrrolidin-3-yl)boronamidic acid;ethane (CID 91135814) is N-dimethyl-N-(3,5,5-trimethyl-2-oxopyrrolidin-3-yl)boronamidic acid;ethane.
What is the SMILES notation for N-dimethyl-N-(3,5,5-trimethyl-2-oxopyrrolidin-3-yl)boronamidic acid;ethane?
The canonical SMILES for N-dimethyl-N-(3,5,5-trimethyl-2-oxopyrrolidin-3-yl)boronamidic acid;ethane is CB(O)N(C)C1(C)CC(C)(C)NC1=O.CC.
What is the InChIKey of N-dimethyl-N-(3,5,5-trimethyl-2-oxopyrrolidin-3-yl)boronamidic acid;ethane?
The InChIKey is SMNLMNDNVYCZLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19BN2O2.C2H6/c1-8(2)6-9(3,7(13)11-8)12(5)10(4)14;1-2/h14H,6H2,1-5H3,(H,11,13);1-2H3.
What are the key properties of N-dimethyl-N-(3,5,5-trimethyl-2-oxopyrrolidin-3-yl)boronamidic acid;ethane?
N-dimethyl-N-(3,5,5-trimethyl-2-oxopyrrolidin-3-yl)boronamidic acid;ethane has a molecular weight of 228.14 g/mol, XLogP of 1.11, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-dimethyl-N-(3,5,5-trimethyl-2-oxopyrrolidin-3-yl)boronamidic acid;ethane is sourced from PubChem (CID 91135814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).