About 4-chloro-2,2-diethyl-1,3-dihydroisoindol-2-ium
4-chloro-2,2-diethyl-1,3-dihydroisoindol-2-ium (PubChem CID 911362) has the molecular formula C12H17ClN+
and a molecular weight of 210.73 g/mol. Its IUPAC name is 4-chloro-2,2-diethyl-1,3-dihydroisoindol-2-ium.
Molecular Properties
| Compound Name | 4-chloro-2,2-diethyl-1,3-dihydroisoindol-2-ium |
| PubChem CID | 911362 |
| Molecular Formula | C12H17ClN+ |
| Molecular Weight | 210.73 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 4-chloro-2,2-diethyl-1,3-dihydroisoindol-2-ium |
| SMILES | CC[N+]1(CC)Cc2cccc(Cl)c2C1 |
| InChI | InChI=1S/C12H17ClN/c1-3-14(4-2)8-10-6-5-7-12(13)11(10)9-14/h5-7H,3-4,8-9H2,1-2H3/q+1 |
| InChIKey | QIZYGRSMLFOTTB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.73 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2,2-diethyl-1,3-dihydroisoindol-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2,2-diethyl-1,3-dihydroisoindol-2-ium?
The IUPAC name of 4-chloro-2,2-diethyl-1,3-dihydroisoindol-2-ium (CID 911362) is 4-chloro-2,2-diethyl-1,3-dihydroisoindol-2-ium.
What is the SMILES notation for 4-chloro-2,2-diethyl-1,3-dihydroisoindol-2-ium?
The canonical SMILES for 4-chloro-2,2-diethyl-1,3-dihydroisoindol-2-ium is CC[N+]1(CC)Cc2cccc(Cl)c2C1.
What is the InChIKey of 4-chloro-2,2-diethyl-1,3-dihydroisoindol-2-ium?
The InChIKey is QIZYGRSMLFOTTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17ClN/c1-3-14(4-2)8-10-6-5-7-12(13)11(10)9-14/h5-7H,3-4,8-9H2,1-2H3/q+1.
What are the key properties of 4-chloro-2,2-diethyl-1,3-dihydroisoindol-2-ium?
4-chloro-2,2-diethyl-1,3-dihydroisoindol-2-ium has a molecular weight of 210.73 g/mol, XLogP of 3.21, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2,2-diethyl-1,3-dihydroisoindol-2-ium is sourced from PubChem (CID 911362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).