About methyl 1-(4,5-dihydro-1H-imidazol-2-yl)piperidine-4-carboxylate
methyl 1-(4,5-dihydro-1H-imidazol-2-yl)piperidine-4-carboxylate (PubChem CID 91136339) has the molecular formula C10H17N3O2
and a molecular weight of 211.26 g/mol. Its IUPAC name is methyl 1-(4,5-dihydro-1H-imidazol-2-yl)piperidine-4-carboxylate.
Molecular Properties
| Compound Name | methyl 1-(4,5-dihydro-1H-imidazol-2-yl)piperidine-4-carboxylate |
| PubChem CID | 91136339 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | methyl 1-(4,5-dihydro-1H-imidazol-2-yl)piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C2=NCCN2)CC1 |
| InChI | InChI=1S/C10H17N3O2/c1-15-9(14)8-2-6-13(7-3-8)10-11-4-5-12-10/h8H,2-7H2,1H3,(H,11,12) |
| InChIKey | PMFCISIDJCFRMA-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 1-(4,5-dihydro-1H-imidazol-2-yl)piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-(4,5-dihydro-1H-imidazol-2-yl)piperidine-4-carboxylate?
The IUPAC name of methyl 1-(4,5-dihydro-1H-imidazol-2-yl)piperidine-4-carboxylate (CID 91136339) is methyl 1-(4,5-dihydro-1H-imidazol-2-yl)piperidine-4-carboxylate.
What is the SMILES notation for methyl 1-(4,5-dihydro-1H-imidazol-2-yl)piperidine-4-carboxylate?
The canonical SMILES for methyl 1-(4,5-dihydro-1H-imidazol-2-yl)piperidine-4-carboxylate is COC(=O)C1CCN(C2=NCCN2)CC1.
What is the InChIKey of methyl 1-(4,5-dihydro-1H-imidazol-2-yl)piperidine-4-carboxylate?
The InChIKey is PMFCISIDJCFRMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O2/c1-15-9(14)8-2-6-13(7-3-8)10-11-4-5-12-10/h8H,2-7H2,1H3,(H,11,12).
What are the key properties of methyl 1-(4,5-dihydro-1H-imidazol-2-yl)piperidine-4-carboxylate?
methyl 1-(4,5-dihydro-1H-imidazol-2-yl)piperidine-4-carboxylate has a molecular weight of 211.26 g/mol, XLogP of -0.17, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(4,5-dihydro-1H-imidazol-2-yl)piperidine-4-carboxylate is sourced from PubChem (CID 91136339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).