C41H70N2O5 — CID 91136357
bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-butyl-2-(3,5-ditert-butyl-4-hydroxyphenyl)propanedioate (PubChem CID 91136357) has the molecular formula C41H70N2O5 and a molecular weight of 671.02 g/mol. Its IUPAC name is bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-butyl-2-(3,5-ditert-butyl-4-hydroxyphenyl)propanedioate.
| Compound Name | bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-butyl-2-(3,5-ditert-butyl-4-hydroxyphenyl)propanedioate |
|---|---|
| PubChem CID | 91136357 |
| Molecular Formula | C41H70N2O5 |
| Molecular Weight | 671.02 g/mol |
| Exact Mass | 670.53 |
| IUPAC Name | bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-butyl-2-(3,5-ditert-butyl-4-hydroxyphenyl)propanedioate |
| SMILES | CCCCC(C(=O)OC1CC(C)(C)N(C)C(C)(C)C1)(C(=O)OC1CC(C)(C)N(C)C(C)(C)C1)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C41H70N2O5/c1-18-19-20-41(33(45)47-28-23-37(8,9)42(16)38(10,11)24-28,34(46)48-29-25-39(12,13)43(17)40(14,15)26-29)27-21-30(35(2,3)4)32(44)31(22-27)36(5,6)7/h21-22,28-29,44H,18-20,23-26H2,1-17H3 |
| InChIKey | JEZSLMLJEKGOJL-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.02 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|