C27H28FN3O7 — CID 91136491
methyl 4-[3-butan-2-yl-5-[4-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]furan-2-yl]-2-methylidenebut-3-enoate (PubChem CID 91136491) has the molecular formula C27H28FN3O7 and a molecular weight of 525.53 g/mol. Its IUPAC name is methyl 4-[3-butan-2-yl-5-[4-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]furan-2-yl]-2-methylidenebut-3-enoate.
| Compound Name | methyl 4-[3-butan-2-yl-5-[4-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]furan-2-yl]-2-methylidenebut-3-enoate |
|---|---|
| PubChem CID | 91136491 |
| Molecular Formula | C27H28FN3O7 |
| Molecular Weight | 525.53 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | methyl 4-[3-butan-2-yl-5-[4-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]furan-2-yl]-2-methylidenebut-3-enoate |
| SMILES | C=C(C=Cc1oc(C2(CN3Cc4ccc(OC)c(F)c4C3=O)NC(=O)NC2=O)cc1C(C)CC)C(=O)OC |
| InChI | InChI=1S/C27H28FN3O7/c1-6-14(2)17-11-20(38-18(17)9-7-15(3)24(33)37-5)27(25(34)29-26(35)30-27)13-31-12-16-8-10-19(36-4)22(28)21(16)23(31)32/h7-11,14H,3,6,12-13H2,1-2,4-5H3,(H2,29,30,34,35) |
| InChIKey | BNHLXNLUFFLCER-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 127.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.53 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|