C10H16F3N — CID 91136503
6,6,6-trifluoro-5-methyl-2-propan-2-ylhex-3-en-1-imine (PubChem CID 91136503) has the molecular formula C10H16F3N and a molecular weight of 207.24 g/mol. Its IUPAC name is 6,6,6-trifluoro-5-methyl-2-propan-2-ylhex-3-en-1-imine.
| Compound Name | 6,6,6-trifluoro-5-methyl-2-propan-2-ylhex-3-en-1-imine |
|---|---|
| PubChem CID | 91136503 |
| Molecular Formula | C10H16F3N |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | 6,6,6-trifluoro-5-methyl-2-propan-2-ylhex-3-en-1-imine |
| SMILES | [H]/N=C/C(C=CC(C)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C10H16F3N/c1-7(2)9(6-14)5-4-8(3)10(11,12)13/h4-9,14H,1-3H3/b5-4?,14-6+ |
| InChIKey | RAMMICRMCWNNCB-ZYHPWCBDSA-N |
| XLogP | 3.66 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|