C25H16F5O2S+ — CID 91136846
[(2,3,4,5,6-pentafluorophenyl)-(triphenyl-λ4-sulfanyl)oxymethylidene]oxidanium (PubChem CID 91136846) has the molecular formula C25H16F5O2S+ and a molecular weight of 475.46 g/mol. Its IUPAC name is [(2,3,4,5,6-pentafluorophenyl)-(triphenyl-λ4-sulfanyl)oxymethylidene]oxidanium.
| Compound Name | [(2,3,4,5,6-pentafluorophenyl)-(triphenyl-λ4-sulfanyl)oxymethylidene]oxidanium |
|---|---|
| PubChem CID | 91136846 |
| Molecular Formula | C25H16F5O2S+ |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | [(2,3,4,5,6-pentafluorophenyl)-(triphenyl-λ4-sulfanyl)oxymethylidene]oxidanium |
| SMILES | [H]/[O+]=C(\OS(c1ccccc1)(c1ccccc1)c1ccccc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C25H15F5O2S/c26-20-19(21(27)23(29)24(30)22(20)28)25(31)32-33(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H/p+1 |
| InChIKey | SMBDFDMXNVWSKC-UHFFFAOYSA-O |
| XLogP | 7.15 |
| TPSA | 30.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|