C28H25FN2O7 — CID 91136891
11-ethoxycarbonyl-6-[(4-fluorocyclohexa-2,4-dien-1-yl)methyl]-12-oxo-10-phenylmethoxy-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-2,5,7,10-tetraene-3-carboxylic acid (PubChem CID 91136891) has the molecular formula C28H25FN2O7 and a molecular weight of 520.51 g/mol. Its IUPAC name is 11-ethoxycarbonyl-6-[(4-fluorocyclohexa-2,4-dien-1-yl)methyl]-12-oxo-10-phenylmethoxy-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-2,5,7,10-tetraene-3-carboxylic acid.
| Compound Name | 11-ethoxycarbonyl-6-[(4-fluorocyclohexa-2,4-dien-1-yl)methyl]-12-oxo-10-phenylmethoxy-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-2,5,7,10-tetraene-3-carboxylic acid |
|---|---|
| PubChem CID | 91136891 |
| Molecular Formula | C28H25FN2O7 |
| Molecular Weight | 520.51 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | 11-ethoxycarbonyl-6-[(4-fluorocyclohexa-2,4-dien-1-yl)methyl]-12-oxo-10-phenylmethoxy-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-2,5,7,10-tetraene-3-carboxylic acid |
| SMILES | CCOC(=O)C1=C(OCc2ccccc2)C2N=CC(CC3C=CC(F)=CC3)=C3OC(C(=O)O)=CN(C1=O)C32 |
| InChI | InChI=1S/C28H25FN2O7/c1-2-36-28(35)21-25(37-15-17-6-4-3-5-7-17)22-23-24(38-20(27(33)34)14-31(23)26(21)32)18(13-30-22)12-16-8-10-19(29)11-9-16/h3-8,10-11,13-14,16,22-23H,2,9,12,15H2,1H3,(H,33,34) |
| InChIKey | DOJRQCSXYSMCQN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 114.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.51 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|