C17H9ClN4O2 — CID 91136892
8-chloro-5-phenyl-12-oxa-5,7,9,16-tetrazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(16),2(6),3,7,11(15),13-hexaen-10-one (PubChem CID 91136892) has the molecular formula C17H9ClN4O2 and a molecular weight of 336.74 g/mol. Its IUPAC name is 8-chloro-5-phenyl-12-oxa-5,7,9,16-tetrazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(16),2(6),3,7,11(15),13-hexaen-10-one.
| Compound Name | 8-chloro-5-phenyl-12-oxa-5,7,9,16-tetrazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(16),2(6),3,7,11(15),13-hexaen-10-one |
|---|---|
| PubChem CID | 91136892 |
| Molecular Formula | C17H9ClN4O2 |
| Molecular Weight | 336.74 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 8-chloro-5-phenyl-12-oxa-5,7,9,16-tetrazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(16),2(6),3,7,11(15),13-hexaen-10-one |
| SMILES | O=c1c2occc2nc2c3ccn(-c4ccccc4)c3nc(Cl)n12 |
| InChI | InChI=1S/C17H9ClN4O2/c18-17-20-14-11(6-8-21(14)10-4-2-1-3-5-10)15-19-12-7-9-24-13(12)16(23)22(15)17/h1-9H |
| InChIKey | OTDOVOCQXCLZBL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 65.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.74 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |