C11H21N3O — CID 91137096
2,2-dimethyl-N'-(2,3,4,5-tetrahydropyridin-6-ylmethyl)propanehydrazide (PubChem CID 91137096) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is 2,2-dimethyl-N'-(2,3,4,5-tetrahydropyridin-6-ylmethyl)propanehydrazide.
| Compound Name | 2,2-dimethyl-N'-(2,3,4,5-tetrahydropyridin-6-ylmethyl)propanehydrazide |
|---|---|
| PubChem CID | 91137096 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 2,2-dimethyl-N'-(2,3,4,5-tetrahydropyridin-6-ylmethyl)propanehydrazide |
| SMILES | CC(C)(C)C(=O)NNCC1=NCCCC1 |
| InChI | InChI=1S/C11H21N3O/c1-11(2,3)10(15)14-13-8-9-6-4-5-7-12-9/h13H,4-8H2,1-3H3,(H,14,15) |
| InChIKey | WAGVZGVAOFRCPQ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|