About 2-hydroxy-N'-(4-imino-1,3-dioxobutan-2-yl)ethanimidamide
2-hydroxy-N'-(4-imino-1,3-dioxobutan-2-yl)ethanimidamide (PubChem CID 91137349) has the molecular formula C6H9N3O3
and a molecular weight of 171.16 g/mol. Its IUPAC name is 2-hydroxy-N'-(4-imino-1,3-dioxobutan-2-yl)ethanimidamide.
Molecular Properties
| Compound Name | 2-hydroxy-N'-(4-imino-1,3-dioxobutan-2-yl)ethanimidamide |
| PubChem CID | 91137349 |
| Molecular Formula | C6H9N3O3 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | 2-hydroxy-N'-(4-imino-1,3-dioxobutan-2-yl)ethanimidamide |
| SMILES | [H]/N=C/C(=O)C(C=O)/N=C(/N)CO |
| InChI | InChI=1S/C6H9N3O3/c7-1-5(12)4(2-10)9-6(8)3-11/h1-2,4,7,11H,3H2,(H2,8,9)/b7-1+ |
| InChIKey | JBYXKPIIQNLGSP-LREOWRDNSA-N |
| XLogP | -1.88 |
| TPSA | 116.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-N'-(4-imino-1,3-dioxobutan-2-yl)ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-N'-(4-imino-1,3-dioxobutan-2-yl)ethanimidamide?
The IUPAC name of 2-hydroxy-N'-(4-imino-1,3-dioxobutan-2-yl)ethanimidamide (CID 91137349) is 2-hydroxy-N'-(4-imino-1,3-dioxobutan-2-yl)ethanimidamide.
What is the SMILES notation for 2-hydroxy-N'-(4-imino-1,3-dioxobutan-2-yl)ethanimidamide?
The canonical SMILES for 2-hydroxy-N'-(4-imino-1,3-dioxobutan-2-yl)ethanimidamide is [H]/N=C/C(=O)C(C=O)/N=C(/N)CO.
What is the InChIKey of 2-hydroxy-N'-(4-imino-1,3-dioxobutan-2-yl)ethanimidamide?
The InChIKey is JBYXKPIIQNLGSP-LREOWRDNSA-N. The full InChI is InChI=1S/C6H9N3O3/c7-1-5(12)4(2-10)9-6(8)3-11/h1-2,4,7,11H,3H2,(H2,8,9)/b7-1+.
What are the key properties of 2-hydroxy-N'-(4-imino-1,3-dioxobutan-2-yl)ethanimidamide?
2-hydroxy-N'-(4-imino-1,3-dioxobutan-2-yl)ethanimidamide has a molecular weight of 171.16 g/mol, XLogP of -1.88, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-N'-(4-imino-1,3-dioxobutan-2-yl)ethanimidamide is sourced from PubChem (CID 91137349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).