C10H13NO3 — CID 91137519
4,7-dimethyl-5,6-dihydro-2H-4,7-epoxyisoindole-1,3-diol (PubChem CID 91137519) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is 4,7-dimethyl-5,6-dihydro-2H-4,7-epoxyisoindole-1,3-diol.
| Compound Name | 4,7-dimethyl-5,6-dihydro-2H-4,7-epoxyisoindole-1,3-diol |
|---|---|
| PubChem CID | 91137519 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 4,7-dimethyl-5,6-dihydro-2H-4,7-epoxyisoindole-1,3-diol |
| SMILES | CC12CCC(C)(O1)c1c(O)[nH]c(O)c12 |
| InChI | InChI=1S/C10H13NO3/c1-9-3-4-10(2,14-9)6-5(9)7(12)11-8(6)13/h11-13H,3-4H2,1-2H3 |
| InChIKey | HPQSMCLDEWAPGN-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 65.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |