C16H34O — CID 91137551
3,3,4,4,6,6-hexamethyl-1-propan-2-yloxyheptane (PubChem CID 91137551) has the molecular formula C16H34O and a molecular weight of 242.45 g/mol. Its IUPAC name is 3,3,4,4,6,6-hexamethyl-1-propan-2-yloxyheptane.
| Compound Name | 3,3,4,4,6,6-hexamethyl-1-propan-2-yloxyheptane |
|---|---|
| PubChem CID | 91137551 |
| Molecular Formula | C16H34O |
| Molecular Weight | 242.45 g/mol |
| Exact Mass | 242.26 |
| IUPAC Name | 3,3,4,4,6,6-hexamethyl-1-propan-2-yloxyheptane |
| SMILES | CC(C)OCCC(C)(C)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C16H34O/c1-13(2)17-11-10-15(6,7)16(8,9)12-14(3,4)5/h13H,10-12H2,1-9H3 |
| InChIKey | YDEZEPHKCNNJSP-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.45 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |