About 1-(4-chlorophenyl)ethyl 5-(2-amino-2-cyclohexylpropyl)-2-methyl-1H-indole-3-carboxylate
1-(4-chlorophenyl)ethyl 5-(2-amino-2-cyclohexylpropyl)-2-methyl-1H-indole-3-carboxylate (PubChem CID 91138238) has the molecular formula C27H33ClN2O2
and a molecular weight of 453.03 g/mol. Its IUPAC name is 1-(4-chlorophenyl)ethyl 5-(2-amino-2-cyclohexylpropyl)-2-methyl-1H-indole-3-carboxylate.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)ethyl 5-(2-amino-2-cyclohexylpropyl)-2-methyl-1H-indole-3-carboxylate |
| PubChem CID | 91138238 |
| Molecular Formula | C27H33ClN2O2 |
| Molecular Weight | 453.03 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 1-(4-chlorophenyl)ethyl 5-(2-amino-2-cyclohexylpropyl)-2-methyl-1H-indole-3-carboxylate |
| SMILES | Cc1[nH]c2ccc(CC(C)(N)C3CCCCC3)cc2c1C(=O)OC(C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H33ClN2O2/c1-17-25(26(31)32-18(2)20-10-12-22(28)13-11-20)23-15-19(9-14-24(23)30-17)16-27(3,29)21-7-5-4-6-8-21/h9-15,18,21,30H,4-8,16,29H2,1-3H3 |
| InChIKey | NFNNYQFPIJMJQT-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.03 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-chlorophenyl)ethyl 5-(2-amino-2-cyclohexylpropyl)-2-methyl-1H-indole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)ethyl 5-(2-amino-2-cyclohexylpropyl)-2-methyl-1H-indole-3-carboxylate?
The IUPAC name of 1-(4-chlorophenyl)ethyl 5-(2-amino-2-cyclohexylpropyl)-2-methyl-1H-indole-3-carboxylate (CID 91138238) is 1-(4-chlorophenyl)ethyl 5-(2-amino-2-cyclohexylpropyl)-2-methyl-1H-indole-3-carboxylate.
What is the SMILES notation for 1-(4-chlorophenyl)ethyl 5-(2-amino-2-cyclohexylpropyl)-2-methyl-1H-indole-3-carboxylate?
The canonical SMILES for 1-(4-chlorophenyl)ethyl 5-(2-amino-2-cyclohexylpropyl)-2-methyl-1H-indole-3-carboxylate is Cc1[nH]c2ccc(CC(C)(N)C3CCCCC3)cc2c1C(=O)OC(C)c1ccc(Cl)cc1.
What is the InChIKey of 1-(4-chlorophenyl)ethyl 5-(2-amino-2-cyclohexylpropyl)-2-methyl-1H-indole-3-carboxylate?
The InChIKey is NFNNYQFPIJMJQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H33ClN2O2/c1-17-25(26(31)32-18(2)20-10-12-22(28)13-11-20)23-15-19(9-14-24(23)30-17)16-27(3,29)21-7-5-4-6-8-21/h9-15,18,21,30H,4-8,16,29H2,1-3H3.
What are the key properties of 1-(4-chlorophenyl)ethyl 5-(2-amino-2-cyclohexylpropyl)-2-methyl-1H-indole-3-carboxylate?
1-(4-chlorophenyl)ethyl 5-(2-amino-2-cyclohexylpropyl)-2-methyl-1H-indole-3-carboxylate has a molecular weight of 453.03 g/mol, XLogP of 6.89, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)ethyl 5-(2-amino-2-cyclohexylpropyl)-2-methyl-1H-indole-3-carboxylate is sourced from PubChem (CID 91138238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).