About 2-hexa-2,4-dien-2-yl-1,5-dimethyl-4H-pyridine
2-hexa-2,4-dien-2-yl-1,5-dimethyl-4H-pyridine (PubChem CID 91138583) has the molecular formula C13H19N
and a molecular weight of 189.30 g/mol. Its IUPAC name is 2-hexa-2,4-dien-2-yl-1,5-dimethyl-4H-pyridine.
Molecular Properties
| Compound Name | 2-hexa-2,4-dien-2-yl-1,5-dimethyl-4H-pyridine |
| PubChem CID | 91138583 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 2-hexa-2,4-dien-2-yl-1,5-dimethyl-4H-pyridine |
| SMILES | CC=CC=C(C)C1=CCC(C)=CN1C |
| InChI | InChI=1S/C13H19N/c1-5-6-7-12(3)13-9-8-11(2)10-14(13)4/h5-7,9-10H,8H2,1-4H3 |
| InChIKey | OKZVAIWSFBABNC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-hexa-2,4-dien-2-yl-1,5-dimethyl-4H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexa-2,4-dien-2-yl-1,5-dimethyl-4H-pyridine?
The IUPAC name of 2-hexa-2,4-dien-2-yl-1,5-dimethyl-4H-pyridine (CID 91138583) is 2-hexa-2,4-dien-2-yl-1,5-dimethyl-4H-pyridine.
What is the SMILES notation for 2-hexa-2,4-dien-2-yl-1,5-dimethyl-4H-pyridine?
The canonical SMILES for 2-hexa-2,4-dien-2-yl-1,5-dimethyl-4H-pyridine is CC=CC=C(C)C1=CCC(C)=CN1C.
What is the InChIKey of 2-hexa-2,4-dien-2-yl-1,5-dimethyl-4H-pyridine?
The InChIKey is OKZVAIWSFBABNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N/c1-5-6-7-12(3)13-9-8-11(2)10-14(13)4/h5-7,9-10H,8H2,1-4H3.
What are the key properties of 2-hexa-2,4-dien-2-yl-1,5-dimethyl-4H-pyridine?
2-hexa-2,4-dien-2-yl-1,5-dimethyl-4H-pyridine has a molecular weight of 189.30 g/mol, XLogP of 3.63, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexa-2,4-dien-2-yl-1,5-dimethyl-4H-pyridine is sourced from PubChem (CID 91138583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).