C17H22N2 — CID 91138721
tert-butyl-[[2-(2-methylcyclopenta-1,3-dien-1-yl)phenyl]methyl]diazene (PubChem CID 91138721) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is tert-butyl-[[2-(2-methylcyclopenta-1,3-dien-1-yl)phenyl]methyl]diazene.
| Compound Name | tert-butyl-[[2-(2-methylcyclopenta-1,3-dien-1-yl)phenyl]methyl]diazene |
|---|---|
| PubChem CID | 91138721 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | tert-butyl-[[2-(2-methylcyclopenta-1,3-dien-1-yl)phenyl]methyl]diazene |
| SMILES | CC1=C(c2ccccc2C/N=N/C(C)(C)C)CC=C1 |
| InChI | InChI=1S/C17H22N2/c1-13-8-7-11-15(13)16-10-6-5-9-14(16)12-18-19-17(2,3)4/h5-10H,11-12H2,1-4H3/b19-18+ |
| InChIKey | XEVUBQVPUWOVKU-VHEBQXMUSA-N |
| XLogP | 5.17 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|