C21H29NO6 — CID 91139094
12-[[di(propan-2-yl)amino]methyl]-7-methyl-3,6,10,15-tetraoxapentacyclo[12.2.1.02,4.05,7.09,13]heptadec-1(17)-ene-11,16-dione (PubChem CID 91139094) has the molecular formula C21H29NO6 and a molecular weight of 391.46 g/mol. Its IUPAC name is 12-[[di(propan-2-yl)amino]methyl]-7-methyl-3,6,10,15-tetraoxapentacyclo[12.2.1.02,4.05,7.09,13]heptadec-1(17)-ene-11,16-dione.
| Compound Name | 12-[[di(propan-2-yl)amino]methyl]-7-methyl-3,6,10,15-tetraoxapentacyclo[12.2.1.02,4.05,7.09,13]heptadec-1(17)-ene-11,16-dione |
|---|---|
| PubChem CID | 91139094 |
| Molecular Formula | C21H29NO6 |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 12-[[di(propan-2-yl)amino]methyl]-7-methyl-3,6,10,15-tetraoxapentacyclo[12.2.1.02,4.05,7.09,13]heptadec-1(17)-ene-11,16-dione |
| SMILES | CC(C)N(CC1C(=O)OC2CC3(C)OC3C3OC3C3=CC(OC3=O)C21)C(C)C |
| InChI | InChI=1S/C21H29NO6/c1-9(2)22(10(3)4)8-12-15-13-6-11(19(23)25-13)16-17(27-16)18-21(5,28-18)7-14(15)26-20(12)24/h6,9-10,12-18H,7-8H2,1-5H3 |
| InChIKey | WWPYFAKNDVEFON-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 80.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|