C53H74O — CID 91139118
1-cyclohexa-1,3-dien-1-yl-10-ethylidene-13-methyl-11-methylidene-8-phenyl-7,9-di(propan-2-ylidene)-6-[1-(4-prop-2-ynylcyclohex-2-en-1-yl)octan-4-yl]tetradeca-4,13-dien-3-ol (PubChem CID 91139118) has the molecular formula C53H74O and a molecular weight of 727.17 g/mol. Its IUPAC name is 1-cyclohexa-1,3-dien-1-yl-10-ethylidene-13-methyl-11-methylidene-8-phenyl-7,9-di(propan-2-ylidene)-6-[1-(4-prop-2-ynylcyclohex-2-en-1-yl)octan-4-yl]tetradeca-4,13-dien-3-ol.
| Compound Name | 1-cyclohexa-1,3-dien-1-yl-10-ethylidene-13-methyl-11-methylidene-8-phenyl-7,9-di(propan-2-ylidene)-6-[1-(4-prop-2-ynylcyclohex-2-en-1-yl)octan-4-yl]tetradeca-4,13-dien-3-ol |
|---|---|
| PubChem CID | 91139118 |
| Molecular Formula | C53H74O |
| Molecular Weight | 727.17 g/mol |
| Exact Mass | 726.57 |
| IUPAC Name | 1-cyclohexa-1,3-dien-1-yl-10-ethylidene-13-methyl-11-methylidene-8-phenyl-7,9-di(propan-2-ylidene)-6-[1-(4-prop-2-ynylcyclohex-2-en-1-yl)octan-4-yl]tetradeca-4,13-dien-3-ol |
| SMILES | C#CCC1C=CC(CCCC(CCCC)C(C=CC(O)CCC2=CC=CCC2)C(=C(C)C)C(C(C(=CC)C(=C)CC(=C)C)=C(C)C)c2ccccc2)CC1 |
| InChI | InChI=1S/C53H74O/c1-11-14-26-46(29-21-25-45-32-30-43(22-12-2)31-33-45)50(37-36-48(54)35-34-44-23-17-15-18-24-44)52(41(8)9)53(47-27-19-16-20-28-47)51(40(6)7)49(13-3)42(10)38-39(4)5/h2,13,15-17,19-20,23,27-28,30,32,36-37,43,45-46,48,50,53-54H,4,10-11,14,18,21-22,24-26,29,31,33-35,38H2,1,3,5-9H3 |
| InChIKey | XFIAWGSTZNOVGZ-UHFFFAOYSA-N |
| XLogP | 15.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.17 |
| LogP ≤ 5 | 15.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|