C22H22Cl3NO3S — CID 91139428
2-ethylthiophene;2,2,2-trichloroethyl 5-methoxy-1,2-dihydrobenzo[e]indole-3-carboxylate (PubChem CID 91139428) has the molecular formula C22H22Cl3NO3S and a molecular weight of 486.85 g/mol. Its IUPAC name is 2-ethylthiophene;2,2,2-trichloroethyl 5-methoxy-1,2-dihydrobenzo[e]indole-3-carboxylate.
| Compound Name | 2-ethylthiophene;2,2,2-trichloroethyl 5-methoxy-1,2-dihydrobenzo[e]indole-3-carboxylate |
|---|---|
| PubChem CID | 91139428 |
| Molecular Formula | C22H22Cl3NO3S |
| Molecular Weight | 486.85 g/mol |
| Exact Mass | 485.04 |
| IUPAC Name | 2-ethylthiophene;2,2,2-trichloroethyl 5-methoxy-1,2-dihydrobenzo[e]indole-3-carboxylate |
| SMILES | CCc1cccs1.COc1cc2c(c3ccccc13)CCN2C(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H14Cl3NO3.C6H8S/c1-22-14-8-13-11(10-4-2-3-5-12(10)14)6-7-20(13)15(21)23-9-16(17,18)19;1-2-6-4-3-5-7-6/h2-5,8H,6-7,9H2,1H3;3-5H,2H2,1H3 |
| InChIKey | VVHDKMSIODUXAK-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.85 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|