About 2-[4-[(2-oxo-1,3-dihydroindol-3-yl)methylideneamino]phenyl]acetic acid
2-[4-[(2-oxo-1,3-dihydroindol-3-yl)methylideneamino]phenyl]acetic acid (PubChem CID 91139489) has the molecular formula C17H14N2O3
and a molecular weight of 294.31 g/mol. Its IUPAC name is 2-[4-[(2-oxo-1,3-dihydroindol-3-yl)methylideneamino]phenyl]acetic acid.
Molecular Properties
| Compound Name | 2-[4-[(2-oxo-1,3-dihydroindol-3-yl)methylideneamino]phenyl]acetic acid |
| PubChem CID | 91139489 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-[4-[(2-oxo-1,3-dihydroindol-3-yl)methylideneamino]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(/N=C/C2C(=O)Nc3ccccc32)cc1 |
| InChI | InChI=1S/C17H14N2O3/c20-16(21)9-11-5-7-12(8-6-11)18-10-14-13-3-1-2-4-15(13)19-17(14)22/h1-8,10,14H,9H2,(H,19,22)(H,20,21)/b18-10+ |
| InChIKey | WWIXNVZGXLNUTE-VCHYOVAHSA-N |
| XLogP | 2.75 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[(2-oxo-1,3-dihydroindol-3-yl)methylideneamino]phenyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(2-oxo-1,3-dihydroindol-3-yl)methylideneamino]phenyl]acetic acid?
The IUPAC name of 2-[4-[(2-oxo-1,3-dihydroindol-3-yl)methylideneamino]phenyl]acetic acid (CID 91139489) is 2-[4-[(2-oxo-1,3-dihydroindol-3-yl)methylideneamino]phenyl]acetic acid.
What is the SMILES notation for 2-[4-[(2-oxo-1,3-dihydroindol-3-yl)methylideneamino]phenyl]acetic acid?
The canonical SMILES for 2-[4-[(2-oxo-1,3-dihydroindol-3-yl)methylideneamino]phenyl]acetic acid is O=C(O)Cc1ccc(/N=C/C2C(=O)Nc3ccccc32)cc1.
What is the InChIKey of 2-[4-[(2-oxo-1,3-dihydroindol-3-yl)methylideneamino]phenyl]acetic acid?
The InChIKey is WWIXNVZGXLNUTE-VCHYOVAHSA-N. The full InChI is InChI=1S/C17H14N2O3/c20-16(21)9-11-5-7-12(8-6-11)18-10-14-13-3-1-2-4-15(13)19-17(14)22/h1-8,10,14H,9H2,(H,19,22)(H,20,21)/b18-10+.
What are the key properties of 2-[4-[(2-oxo-1,3-dihydroindol-3-yl)methylideneamino]phenyl]acetic acid?
2-[4-[(2-oxo-1,3-dihydroindol-3-yl)methylideneamino]phenyl]acetic acid has a molecular weight of 294.31 g/mol, XLogP of 2.75, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(2-oxo-1,3-dihydroindol-3-yl)methylideneamino]phenyl]acetic acid is sourced from PubChem (CID 91139489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).