About N-cycloheptyl-2-(2,4-dimethoxyphenyl)acetamide
N-cycloheptyl-2-(2,4-dimethoxyphenyl)acetamide (PubChem CID 9113959) has the molecular formula C17H25NO3
and a molecular weight of 291.39 g/mol. Its IUPAC name is N-cycloheptyl-2-(2,4-dimethoxyphenyl)acetamide.
Molecular Properties
| Compound Name | N-cycloheptyl-2-(2,4-dimethoxyphenyl)acetamide |
| PubChem CID | 9113959 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | N-cycloheptyl-2-(2,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)NC2CCCCCC2)c(OC)c1 |
| InChI | InChI=1S/C17H25NO3/c1-20-15-10-9-13(16(12-15)21-2)11-17(19)18-14-7-5-3-4-6-8-14/h9-10,12,14H,3-8,11H2,1-2H3,(H,18,19) |
| InChIKey | YPIAGTLYAJUKSH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cycloheptyl-2-(2,4-dimethoxyphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cycloheptyl-2-(2,4-dimethoxyphenyl)acetamide?
The IUPAC name of N-cycloheptyl-2-(2,4-dimethoxyphenyl)acetamide (CID 9113959) is N-cycloheptyl-2-(2,4-dimethoxyphenyl)acetamide.
What is the SMILES notation for N-cycloheptyl-2-(2,4-dimethoxyphenyl)acetamide?
The canonical SMILES for N-cycloheptyl-2-(2,4-dimethoxyphenyl)acetamide is COc1ccc(CC(=O)NC2CCCCCC2)c(OC)c1.
What is the InChIKey of N-cycloheptyl-2-(2,4-dimethoxyphenyl)acetamide?
The InChIKey is YPIAGTLYAJUKSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO3/c1-20-15-10-9-13(16(12-15)21-2)11-17(19)18-14-7-5-3-4-6-8-14/h9-10,12,14H,3-8,11H2,1-2H3,(H,18,19).
What are the key properties of N-cycloheptyl-2-(2,4-dimethoxyphenyl)acetamide?
N-cycloheptyl-2-(2,4-dimethoxyphenyl)acetamide has a molecular weight of 291.39 g/mol, XLogP of 3.09, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cycloheptyl-2-(2,4-dimethoxyphenyl)acetamide is sourced from PubChem (CID 9113959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).