C24H22N4O6 — CID 91139696
[4-[carboxy-[(3-methoxyphenyl)methylideneamino]amino]phenyl]-[(3-methoxyphenyl)methylideneamino]carbamic acid (PubChem CID 91139696) has the molecular formula C24H22N4O6 and a molecular weight of 462.46 g/mol. Its IUPAC name is [4-[carboxy-[(3-methoxyphenyl)methylideneamino]amino]phenyl]-[(3-methoxyphenyl)methylideneamino]carbamic acid.
| Compound Name | [4-[carboxy-[(3-methoxyphenyl)methylideneamino]amino]phenyl]-[(3-methoxyphenyl)methylideneamino]carbamic acid |
|---|---|
| PubChem CID | 91139696 |
| Molecular Formula | C24H22N4O6 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | [4-[carboxy-[(3-methoxyphenyl)methylideneamino]amino]phenyl]-[(3-methoxyphenyl)methylideneamino]carbamic acid |
| SMILES | COc1cccc(C=NN(C(=O)O)c2ccc(N(N=Cc3cccc(OC)c3)C(=O)O)cc2)c1 |
| InChI | InChI=1S/C24H22N4O6/c1-33-21-7-3-5-17(13-21)15-25-27(23(29)30)19-9-11-20(12-10-19)28(24(31)32)26-16-18-6-4-8-22(14-18)34-2/h3-16H,1-2H3,(H,29,30)(H,31,32) |
| InChIKey | ZXVSNZDFKDJRME-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 124.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|