C19H12N6O — CID 91139812
4-(5-isocyano-6-phenyl-4,5-dihydro-1H-pyrazolo[5,4-b]pyridin-4-yl)-2,1,3-benzoxadiazole (PubChem CID 91139812) has the molecular formula C19H12N6O and a molecular weight of 340.35 g/mol. Its IUPAC name is 4-(5-isocyano-6-phenyl-4,5-dihydro-1H-pyrazolo[5,4-b]pyridin-4-yl)-2,1,3-benzoxadiazole.
| Compound Name | 4-(5-isocyano-6-phenyl-4,5-dihydro-1H-pyrazolo[5,4-b]pyridin-4-yl)-2,1,3-benzoxadiazole |
|---|---|
| PubChem CID | 91139812 |
| Molecular Formula | C19H12N6O |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 4-(5-isocyano-6-phenyl-4,5-dihydro-1H-pyrazolo[5,4-b]pyridin-4-yl)-2,1,3-benzoxadiazole |
| SMILES | [C-]#[N+]C1C(c2ccccc2)=Nc2[nH]ncc2C1c1cccc2nonc12 |
| InChI | InChI=1S/C19H12N6O/c1-20-18-15(12-8-5-9-14-17(12)25-26-24-14)13-10-21-23-19(13)22-16(18)11-6-3-2-4-7-11/h2-10,15,18H,(H,21,23) |
| InChIKey | MHPPJIDUGQEHHV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|