C19H21F3N6O2 — CID 91139947
3-[4-[6-(2-aminopyridine-3-carboximidoyl)-5-(trifluoromethyl)-2-pyridinyl]piperazin-2-yl]oxetan-3-ol (PubChem CID 91139947) has the molecular formula C19H21F3N6O2 and a molecular weight of 422.41 g/mol. Its IUPAC name is 3-[4-[6-(2-aminopyridine-3-carboximidoyl)-5-(trifluoromethyl)-2-pyridinyl]piperazin-2-yl]oxetan-3-ol.
| Compound Name | 3-[4-[6-(2-aminopyridine-3-carboximidoyl)-5-(trifluoromethyl)-2-pyridinyl]piperazin-2-yl]oxetan-3-ol |
|---|---|
| PubChem CID | 91139947 |
| Molecular Formula | C19H21F3N6O2 |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 3-[4-[6-(2-aminopyridine-3-carboximidoyl)-5-(trifluoromethyl)-2-pyridinyl]piperazin-2-yl]oxetan-3-ol |
| SMILES | [H]/N=C(\c1cccnc1N)c1nc(N2CCNC(C3(O)COC3)C2)ccc1C(F)(F)F |
| InChI | InChI=1S/C19H21F3N6O2/c20-19(21,22)12-3-4-14(27-16(12)15(23)11-2-1-5-26-17(11)24)28-7-6-25-13(8-28)18(29)9-30-10-18/h1-5,13,23,25,29H,6-10H2,(H2,24,26)/b23-15+ |
| InChIKey | DZNOWENRCOJARD-HZHRSRAPSA-N |
| XLogP | 1.03 |
| TPSA | 120.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|