C21H24ClNO4S2 — CID 91140332
(4'R,6'R,8'R)-16'-chloro-17',19'-dihydroxy-4'-methylspiro[1,3-dithiane-2,13'-7-oxa-3-azatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaene]-2'-one (PubChem CID 91140332) has the molecular formula C21H24ClNO4S2 and a molecular weight of 454.01 g/mol. Its IUPAC name is (4'R,6'R,8'R)-16'-chloro-17',19'-dihydroxy-4'-methylspiro[1,3-dithiane-2,13'-7-oxa-3-azatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaene]-2'-one.
| Compound Name | (4'R,6'R,8'R)-16'-chloro-17',19'-dihydroxy-4'-methylspiro[1,3-dithiane-2,13'-7-oxa-3-azatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaene]-2'-one |
|---|---|
| PubChem CID | 91140332 |
| Molecular Formula | C21H24ClNO4S2 |
| Molecular Weight | 454.01 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | (4'R,6'R,8'R)-16'-chloro-17',19'-dihydroxy-4'-methylspiro[1,3-dithiane-2,13'-7-oxa-3-azatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaene]-2'-one |
| SMILES | C[C@@H]1C[C@H]2O[C@@H]2C=CC=CC2(Cc3c(Cl)c(O)cc(O)c3C(=O)N1)SCCCS2 |
| InChI | InChI=1S/C21H24ClNO4S2/c1-12-9-17-16(27-17)5-2-3-6-21(28-7-4-8-29-21)11-13-18(20(26)23-12)14(24)10-15(25)19(13)22/h2-3,5-6,10,12,16-17,24-25H,4,7-9,11H2,1H3,(H,23,26)/t12-,16-,17-/m1/s1 |
| InChIKey | GFXYGPUESTZYMU-CSMYWGQOSA-N |
| XLogP | 4.26 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.01 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|