About 2-benzylsulfonyl-6-ethyl-3,4,5-trimethyloxane;ethane
2-benzylsulfonyl-6-ethyl-3,4,5-trimethyloxane;ethane (PubChem CID 91140986) has the molecular formula C19H32O3S
and a molecular weight of 340.53 g/mol. Its IUPAC name is 2-benzylsulfonyl-6-ethyl-3,4,5-trimethyloxane;ethane.
Molecular Properties
| Compound Name | 2-benzylsulfonyl-6-ethyl-3,4,5-trimethyloxane;ethane |
| PubChem CID | 91140986 |
| Molecular Formula | C19H32O3S |
| Molecular Weight | 340.53 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | 2-benzylsulfonyl-6-ethyl-3,4,5-trimethyloxane;ethane |
| SMILES | CC.CCC1OC(S(=O)(=O)Cc2ccccc2)C(C)C(C)C1C |
| InChI | InChI=1S/C17H26O3S.C2H6/c1-5-16-13(3)12(2)14(4)17(20-16)21(18,19)11-15-9-7-6-8-10-15;1-2/h6-10,12-14,16-17H,5,11H2,1-4H3;1-2H3 |
| InChIKey | XGAUOZAOKZOQOD-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.53 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-benzylsulfonyl-6-ethyl-3,4,5-trimethyloxane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylsulfonyl-6-ethyl-3,4,5-trimethyloxane;ethane?
The IUPAC name of 2-benzylsulfonyl-6-ethyl-3,4,5-trimethyloxane;ethane (CID 91140986) is 2-benzylsulfonyl-6-ethyl-3,4,5-trimethyloxane;ethane.
What is the SMILES notation for 2-benzylsulfonyl-6-ethyl-3,4,5-trimethyloxane;ethane?
The canonical SMILES for 2-benzylsulfonyl-6-ethyl-3,4,5-trimethyloxane;ethane is CC.CCC1OC(S(=O)(=O)Cc2ccccc2)C(C)C(C)C1C.
What is the InChIKey of 2-benzylsulfonyl-6-ethyl-3,4,5-trimethyloxane;ethane?
The InChIKey is XGAUOZAOKZOQOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O3S.C2H6/c1-5-16-13(3)12(2)14(4)17(20-16)21(18,19)11-15-9-7-6-8-10-15;1-2/h6-10,12-14,16-17H,5,11H2,1-4H3;1-2H3.
What are the key properties of 2-benzylsulfonyl-6-ethyl-3,4,5-trimethyloxane;ethane?
2-benzylsulfonyl-6-ethyl-3,4,5-trimethyloxane;ethane has a molecular weight of 340.53 g/mol, XLogP of 4.67, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylsulfonyl-6-ethyl-3,4,5-trimethyloxane;ethane is sourced from PubChem (CID 91140986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).