C42H81N5O4 — CID 91141709
N-[6-[acetyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide;(2,2,6,6-tetramethylpiperidin-4-yl) 2-methylbutanoate (PubChem CID 91141709) has the molecular formula C42H81N5O4 and a molecular weight of 720.14 g/mol. Its IUPAC name is N-[6-[acetyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide;(2,2,6,6-tetramethylpiperidin-4-yl) 2-methylbutanoate.
| Compound Name | N-[6-[acetyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide;(2,2,6,6-tetramethylpiperidin-4-yl) 2-methylbutanoate |
|---|---|
| PubChem CID | 91141709 |
| Molecular Formula | C42H81N5O4 |
| Molecular Weight | 720.14 g/mol |
| Exact Mass | 719.63 |
| IUPAC Name | N-[6-[acetyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide;(2,2,6,6-tetramethylpiperidin-4-yl) 2-methylbutanoate |
| SMILES | CC(=O)N(CCCCCCN(C(C)=O)C1CC(C)(C)NC(C)(C)C1)C1CC(C)(C)NC(C)(C)C1.CCC(C)C(=O)OC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C28H54N4O2.C14H27NO2/c1-21(33)31(23-17-25(3,4)29-26(5,6)18-23)15-13-11-12-14-16-32(22(2)34)24-19-27(7,8)30-28(9,10)20-24;1-7-10(2)12(16)17-11-8-13(3,4)15-14(5,6)9-11/h23-24,29-30H,11-20H2,1-10H3;10-11,15H,7-9H2,1-6H3 |
| InChIKey | AJNSSVFPWRJAGY-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.14 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|