C33H44N4O — CID 91141761
(1S)-N-[2-[2-(2,6-diethylphenyl)-4-(2,2-dimethylmorpholin-4-yl)-6-methylpyrimidin-5-yl]ethyl]-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 91141761) has the molecular formula C33H44N4O and a molecular weight of 512.74 g/mol. Its IUPAC name is (1S)-N-[2-[2-(2,6-diethylphenyl)-4-(2,2-dimethylmorpholin-4-yl)-6-methylpyrimidin-5-yl]ethyl]-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | (1S)-N-[2-[2-(2,6-diethylphenyl)-4-(2,2-dimethylmorpholin-4-yl)-6-methylpyrimidin-5-yl]ethyl]-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 91141761 |
| Molecular Formula | C33H44N4O |
| Molecular Weight | 512.74 g/mol |
| Exact Mass | 512.35 |
| IUPAC Name | (1S)-N-[2-[2-(2,6-diethylphenyl)-4-(2,2-dimethylmorpholin-4-yl)-6-methylpyrimidin-5-yl]ethyl]-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | CCc1cccc(CC)c1-c1nc(C)c(CCN[C@H]2CCCc3ccccc32)c(N2CCOC(C)(C)C2)n1 |
| InChI | InChI=1S/C33H44N4O/c1-6-24-13-10-14-25(7-2)30(24)31-35-23(3)27(32(36-31)37-20-21-38-33(4,5)22-37)18-19-34-29-17-11-15-26-12-8-9-16-28(26)29/h8-10,12-14,16,29,34H,6-7,11,15,17-22H2,1-5H3/t29-/m0/s1 |
| InChIKey | NDZFJMOFRPUOLQ-LJAQVGFWSA-N |
| XLogP | 6.40 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.74 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |