C14H28 — CID 91142167
2-tert-butyl-1,1,5,5-tetramethylcyclohexane (PubChem CID 91142167) has the molecular formula C14H28 and a molecular weight of 196.38 g/mol. Its IUPAC name is 2-tert-butyl-1,1,5,5-tetramethylcyclohexane.
| Compound Name | 2-tert-butyl-1,1,5,5-tetramethylcyclohexane |
|---|---|
| PubChem CID | 91142167 |
| Molecular Formula | C14H28 |
| Molecular Weight | 196.38 g/mol |
| Exact Mass | 196.22 |
| IUPAC Name | 2-tert-butyl-1,1,5,5-tetramethylcyclohexane |
| SMILES | CC1(C)CCC(C(C)(C)C)C(C)(C)C1 |
| InChI | InChI=1S/C14H28/c1-12(2,3)11-8-9-13(4,5)10-14(11,6)7/h11H,8-10H2,1-7H3 |
| InChIKey | RSCALVWBKWGRIG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.38 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |