C20H36 — CID 91142796
2,3,4,5-tetramethylhexa-2,4-diene (PubChem CID 91142796) has the molecular formula C20H36 and a molecular weight of 276.51 g/mol. Its IUPAC name is 2,3,4,5-tetramethylhexa-2,4-diene.
| Compound Name | 2,3,4,5-tetramethylhexa-2,4-diene |
|---|---|
| PubChem CID | 91142796 |
| Molecular Formula | C20H36 |
| Molecular Weight | 276.51 g/mol |
| Exact Mass | 276.28 |
| IUPAC Name | 2,3,4,5-tetramethylhexa-2,4-diene |
| SMILES | CC(C)=C(C)C(C)=C(C)C.CC(C)=C(C)C(C)=C(C)C |
| InChI | InChI=1S/2C10H18/c2*1-7(2)9(5)10(6)8(3)4/h2*1-6H3 |
| InChIKey | FQGYGLINEFXJTO-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.51 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|