C22H17FN4O4S — CID 91142828
5-(4-fluorophenyl)-5-[[1-hydroxy-5-(1,3-thiazol-2-ylmethoxy)isoindol-2-yl]methyl]imidazolidine-2,4-dione (PubChem CID 91142828) has the molecular formula C22H17FN4O4S and a molecular weight of 452.47 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-5-[[1-hydroxy-5-(1,3-thiazol-2-ylmethoxy)isoindol-2-yl]methyl]imidazolidine-2,4-dione.
| Compound Name | 5-(4-fluorophenyl)-5-[[1-hydroxy-5-(1,3-thiazol-2-ylmethoxy)isoindol-2-yl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 91142828 |
| Molecular Formula | C22H17FN4O4S |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 5-(4-fluorophenyl)-5-[[1-hydroxy-5-(1,3-thiazol-2-ylmethoxy)isoindol-2-yl]methyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Cn2cc3cc(OCc4nccs4)ccc3c2O)(c2ccc(F)cc2)N1 |
| InChI | InChI=1S/C22H17FN4O4S/c23-15-3-1-14(2-4-15)22(20(29)25-21(30)26-22)12-27-10-13-9-16(5-6-17(13)19(27)28)31-11-18-24-7-8-32-18/h1-10,28H,11-12H2,(H2,25,26,29,30) |
| InChIKey | GXGCZLAZVZTKPP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|