About 5-(2,3-dimethylbutan-2-yl)-5-fluoro-6-methylidenedec-1-ene
5-(2,3-dimethylbutan-2-yl)-5-fluoro-6-methylidenedec-1-ene (PubChem CID 91142848) has the molecular formula C17H31F
and a molecular weight of 254.43 g/mol. Its IUPAC name is 5-(2,3-dimethylbutan-2-yl)-5-fluoro-6-methylidenedec-1-ene.
Molecular Properties
| Compound Name | 5-(2,3-dimethylbutan-2-yl)-5-fluoro-6-methylidenedec-1-ene |
| PubChem CID | 91142848 |
| Molecular Formula | C17H31F |
| Molecular Weight | 254.43 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | 5-(2,3-dimethylbutan-2-yl)-5-fluoro-6-methylidenedec-1-ene |
| SMILES | C=CCCC(F)(C(=C)CCCC)C(C)(C)C(C)C |
| InChI | InChI=1S/C17H31F/c1-8-10-12-15(5)17(18,13-11-9-2)16(6,7)14(3)4/h9,14H,2,5,8,10-13H2,1,3-4,6-7H3 |
| InChIKey | YHJSUUFVEAECAD-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.43 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,3-dimethylbutan-2-yl)-5-fluoro-6-methylidenedec-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,3-dimethylbutan-2-yl)-5-fluoro-6-methylidenedec-1-ene?
The IUPAC name of 5-(2,3-dimethylbutan-2-yl)-5-fluoro-6-methylidenedec-1-ene (CID 91142848) is 5-(2,3-dimethylbutan-2-yl)-5-fluoro-6-methylidenedec-1-ene.
What is the SMILES notation for 5-(2,3-dimethylbutan-2-yl)-5-fluoro-6-methylidenedec-1-ene?
The canonical SMILES for 5-(2,3-dimethylbutan-2-yl)-5-fluoro-6-methylidenedec-1-ene is C=CCCC(F)(C(=C)CCCC)C(C)(C)C(C)C.
What is the InChIKey of 5-(2,3-dimethylbutan-2-yl)-5-fluoro-6-methylidenedec-1-ene?
The InChIKey is YHJSUUFVEAECAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H31F/c1-8-10-12-15(5)17(18,13-11-9-2)16(6,7)14(3)4/h9,14H,2,5,8,10-13H2,1,3-4,6-7H3.
What are the key properties of 5-(2,3-dimethylbutan-2-yl)-5-fluoro-6-methylidenedec-1-ene?
5-(2,3-dimethylbutan-2-yl)-5-fluoro-6-methylidenedec-1-ene has a molecular weight of 254.43 g/mol, XLogP of 6.09, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,3-dimethylbutan-2-yl)-5-fluoro-6-methylidenedec-1-ene is sourced from PubChem (CID 91142848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).