C21H21FN6O5 — CID 91143028
3-[(2S,3S,4R)-2-[2-[2-(4-fluorophenyl)ethynyl]-6-(methoxyamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]propanamide (PubChem CID 91143028) has the molecular formula C21H21FN6O5 and a molecular weight of 456.43 g/mol. Its IUPAC name is 3-[(2S,3S,4R)-2-[2-[2-(4-fluorophenyl)ethynyl]-6-(methoxyamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]propanamide.
| Compound Name | 3-[(2S,3S,4R)-2-[2-[2-(4-fluorophenyl)ethynyl]-6-(methoxyamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]propanamide |
|---|---|
| PubChem CID | 91143028 |
| Molecular Formula | C21H21FN6O5 |
| Molecular Weight | 456.43 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 3-[(2S,3S,4R)-2-[2-[2-(4-fluorophenyl)ethynyl]-6-(methoxyamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]propanamide |
| SMILES | CONc1nc(C#Cc2ccc(F)cc2)nc2c1ncn2[C@@]1(CCC(N)=O)OC[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H21FN6O5/c1-32-27-19-17-20(26-16(25-19)7-4-12-2-5-13(22)6-3-12)28(11-24-17)21(9-8-15(23)30)18(31)14(29)10-33-21/h2-3,5-6,11,14,18,29,31H,8-10H2,1H3,(H2,23,30)(H,25,26,27)/t14-,18+,21+/m1/s1 |
| InChIKey | NADIDYDQKLZPOK-IBZMOEQTSA-N |
| XLogP | 0.01 |
| TPSA | 157.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.43 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|