C22H20F2N4O4 — CID 91143363
3-(3,5-difluorophenyl)-1-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-4-yl]methyl]-1-methylurea (PubChem CID 91143363) has the molecular formula C22H20F2N4O4 and a molecular weight of 442.42 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)-1-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-4-yl]methyl]-1-methylurea.
| Compound Name | 3-(3,5-difluorophenyl)-1-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-4-yl]methyl]-1-methylurea |
|---|---|
| PubChem CID | 91143363 |
| Molecular Formula | C22H20F2N4O4 |
| Molecular Weight | 442.42 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 3-(3,5-difluorophenyl)-1-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxyisoindol-4-yl]methyl]-1-methylurea |
| SMILES | CN(Cc1cccc2c(O)n(C3CCC(=O)NC3=O)cc12)C(=O)Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C22H20F2N4O4/c1-27(22(32)25-15-8-13(23)7-14(24)9-15)10-12-3-2-4-16-17(12)11-28(21(16)31)18-5-6-19(29)26-20(18)30/h2-4,7-9,11,18,31H,5-6,10H2,1H3,(H,25,32)(H,26,29,30) |
| InChIKey | RGXIBPRLWLLINV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 103.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|