C20H40O3Si — CID 91143448
(3S,4S,7S)-3-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-2,4,6,6-tetramethyldec-9-en-5-one (PubChem CID 91143448) has the molecular formula C20H40O3Si and a molecular weight of 356.62 g/mol. Its IUPAC name is (3S,4S,7S)-3-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-2,4,6,6-tetramethyldec-9-en-5-one.
| Compound Name | (3S,4S,7S)-3-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-2,4,6,6-tetramethyldec-9-en-5-one |
|---|---|
| PubChem CID | 91143448 |
| Molecular Formula | C20H40O3Si |
| Molecular Weight | 356.62 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | (3S,4S,7S)-3-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-2,4,6,6-tetramethyldec-9-en-5-one |
| SMILES | C=CC[C@H](O)C(C)(C)C(=O)[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C20H40O3Si/c1-12-13-16(21)20(8,9)18(22)15(4)17(14(2)3)23-24(10,11)19(5,6)7/h12,14-17,21H,1,13H2,2-11H3/t15-,16-,17-/m0/s1 |
| InChIKey | SOCFAQDEXNXGJA-ULQDDVLXSA-N |
| XLogP | 5.20 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.62 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|