About 4-(3,4-dimethoxyphenoxy)-1,3-thiazole
4-(3,4-dimethoxyphenoxy)-1,3-thiazole (PubChem CID 91143462) has the molecular formula C11H11NO3S
and a molecular weight of 237.28 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenoxy)-1,3-thiazole.
Molecular Properties
| Compound Name | 4-(3,4-dimethoxyphenoxy)-1,3-thiazole |
| PubChem CID | 91143462 |
| Molecular Formula | C11H11NO3S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 4-(3,4-dimethoxyphenoxy)-1,3-thiazole |
| SMILES | COc1ccc(Oc2cscn2)cc1OC |
| InChI | InChI=1S/C11H11NO3S/c1-13-9-4-3-8(5-10(9)14-2)15-11-6-16-7-12-11/h3-7H,1-2H3 |
| InChIKey | UELMZMBXVCBHOX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(3,4-dimethoxyphenoxy)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dimethoxyphenoxy)-1,3-thiazole?
The IUPAC name of 4-(3,4-dimethoxyphenoxy)-1,3-thiazole (CID 91143462) is 4-(3,4-dimethoxyphenoxy)-1,3-thiazole.
What is the SMILES notation for 4-(3,4-dimethoxyphenoxy)-1,3-thiazole?
The canonical SMILES for 4-(3,4-dimethoxyphenoxy)-1,3-thiazole is COc1ccc(Oc2cscn2)cc1OC.
What is the InChIKey of 4-(3,4-dimethoxyphenoxy)-1,3-thiazole?
The InChIKey is UELMZMBXVCBHOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO3S/c1-13-9-4-3-8(5-10(9)14-2)15-11-6-16-7-12-11/h3-7H,1-2H3.
What are the key properties of 4-(3,4-dimethoxyphenoxy)-1,3-thiazole?
4-(3,4-dimethoxyphenoxy)-1,3-thiazole has a molecular weight of 237.28 g/mol, XLogP of 2.95, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dimethoxyphenoxy)-1,3-thiazole is sourced from PubChem (CID 91143462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).