C41H83N3O5 — CID 91143535
4-(6-amino-4-methylheptyl)-8-[[1,4-dihydroxy-5-[(1-hydroxy-2,4-dimethylpentyl)amino]-3-methylidene-2-pentyloctyl]amino]-6-methylideneundecane-3,7-diol (PubChem CID 91143535) has the molecular formula C41H83N3O5 and a molecular weight of 698.13 g/mol. Its IUPAC name is 4-(6-amino-4-methylheptyl)-8-[[1,4-dihydroxy-5-[(1-hydroxy-2,4-dimethylpentyl)amino]-3-methylidene-2-pentyloctyl]amino]-6-methylideneundecane-3,7-diol.
| Compound Name | 4-(6-amino-4-methylheptyl)-8-[[1,4-dihydroxy-5-[(1-hydroxy-2,4-dimethylpentyl)amino]-3-methylidene-2-pentyloctyl]amino]-6-methylideneundecane-3,7-diol |
|---|---|
| PubChem CID | 91143535 |
| Molecular Formula | C41H83N3O5 |
| Molecular Weight | 698.13 g/mol |
| Exact Mass | 697.63 |
| IUPAC Name | 4-(6-amino-4-methylheptyl)-8-[[1,4-dihydroxy-5-[(1-hydroxy-2,4-dimethylpentyl)amino]-3-methylidene-2-pentyloctyl]amino]-6-methylideneundecane-3,7-diol |
| SMILES | C=C(CC(CCCC(C)CC(C)N)C(O)CC)C(O)C(CCC)NC(O)C(CCCCC)C(=C)C(O)C(CCC)NC(O)C(C)CC(C)C |
| InChI | InChI=1S/C41H83N3O5/c1-12-16-17-23-34(32(11)39(47)36(20-14-3)43-40(48)30(9)24-27(5)6)41(49)44-35(19-13-2)38(46)29(8)26-33(37(45)15-4)22-18-21-28(7)25-31(10)42/h27-28,30-31,33-41,43-49H,8,11-26,42H2,1-7,9-10H3 |
| InChIKey | VEZIARLLTOPFAK-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 151.23 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.13 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|