About 2-bromo-1-(5-phenyl-2,5-dihydro-1,2-oxazol-3-yl)ethanone
2-bromo-1-(5-phenyl-2,5-dihydro-1,2-oxazol-3-yl)ethanone (PubChem CID 91144733) has the molecular formula C11H10BrNO2
and a molecular weight of 268.11 g/mol. Its IUPAC name is 2-bromo-1-(5-phenyl-2,5-dihydro-1,2-oxazol-3-yl)ethanone.
Molecular Properties
| Compound Name | 2-bromo-1-(5-phenyl-2,5-dihydro-1,2-oxazol-3-yl)ethanone |
| PubChem CID | 91144733 |
| Molecular Formula | C11H10BrNO2 |
| Molecular Weight | 268.11 g/mol |
| Exact Mass | 266.99 |
| IUPAC Name | 2-bromo-1-(5-phenyl-2,5-dihydro-1,2-oxazol-3-yl)ethanone |
| SMILES | O=C(CBr)C1=CC(c2ccccc2)ON1 |
| InChI | InChI=1S/C11H10BrNO2/c12-7-10(14)9-6-11(15-13-9)8-4-2-1-3-5-8/h1-6,11,13H,7H2 |
| InChIKey | MRENCVAMPNULFE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.11 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1-(5-phenyl-2,5-dihydro-1,2-oxazol-3-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1-(5-phenyl-2,5-dihydro-1,2-oxazol-3-yl)ethanone?
The IUPAC name of 2-bromo-1-(5-phenyl-2,5-dihydro-1,2-oxazol-3-yl)ethanone (CID 91144733) is 2-bromo-1-(5-phenyl-2,5-dihydro-1,2-oxazol-3-yl)ethanone.
What is the SMILES notation for 2-bromo-1-(5-phenyl-2,5-dihydro-1,2-oxazol-3-yl)ethanone?
The canonical SMILES for 2-bromo-1-(5-phenyl-2,5-dihydro-1,2-oxazol-3-yl)ethanone is O=C(CBr)C1=CC(c2ccccc2)ON1.
What is the InChIKey of 2-bromo-1-(5-phenyl-2,5-dihydro-1,2-oxazol-3-yl)ethanone?
The InChIKey is MRENCVAMPNULFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10BrNO2/c12-7-10(14)9-6-11(15-13-9)8-4-2-1-3-5-8/h1-6,11,13H,7H2.
What are the key properties of 2-bromo-1-(5-phenyl-2,5-dihydro-1,2-oxazol-3-yl)ethanone?
2-bromo-1-(5-phenyl-2,5-dihydro-1,2-oxazol-3-yl)ethanone has a molecular weight of 268.11 g/mol, XLogP of 2.11, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1-(5-phenyl-2,5-dihydro-1,2-oxazol-3-yl)ethanone is sourced from PubChem (CID 91144733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).